Products 13540-66-4

CAS 13540-66-4 is the registry number for 3,3-Dimethyl-4-phenylbutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,3-dimethyl-4-phenylbutanoic acid (CAS 13540-66-4) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 3,3-dimethyl-4-phenylbutanoic acid. InChIKey: GNOFKHUWYJOONC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O2
Molecular weight192.25 g/mol
IUPAC name3,3-dimethyl-4-phenylbutanoic acid
InChIKeyGNOFKHUWYJOONC-UHFFFAOYSA-N
SMILESCC(C)(CC1=CC=CC=C1)CC(=O)O

Computed by PubChem (NCBI)