CAS 1354003-97-6 appears in our catalog under these names: (S)-tert-Butyl cyclopropyl(pyrrolidin-3-yl)carbamate, 97%, Cyclopropyl-(S)-pyrrolidin-3-yl-carbamic acid tert-butyl ester. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 50mg, 25mg, 100mg, 250mg, 500mg.
Tert-butyl N-cyclopropyl-N-[(3S)-pyrrolidin-3-yl]carbamate (CAS 1354003-97-6) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-cyclopropyl-N-[(3S)-pyrrolidin-3-yl]carbamate. InChIKey: OISBACWDCRUUAL-JTQLQIEISA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl N-cyclopropyl-N-[(3S)-pyrrolidin-3-yl]carbamate |
| InChIKey | OISBACWDCRUUAL-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N([C@H]1CCNC1)C2CC2 |
Computed by PubChem (NCBI)