Products 1354020-10-2
CAS 1354020-10-2 is the registry number for (S)-2-Amino-1-(4-chloro-piperidin-1-yl)-propan-1-one. Offered by: Biosynth. Available pack sizes: 1000mg.
(2S)-2-amino-1-(4-chloropiperidin-1-yl)propan-1-one (CAS 1354020-10-2) is a chemical compound with the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. IUPAC name: (2S)-2-amino-1-(4-chloropiperidin-1-yl)propan-1-one. InChIKey: MNSZKJHJJYSRAK-LURJTMIESA-N.
| Molecular formula | C8H15ClN2O |
|---|---|
| Molecular weight | 190.67 g/mol |
| IUPAC name | (2S)-2-amino-1-(4-chloropiperidin-1-yl)propan-1-one |
| InChIKey | MNSZKJHJJYSRAK-LURJTMIESA-N |
| SMILES | C[C@@H](C(=O)N1CCC(CC1)Cl)N |
Computed by PubChem (NCBI)