CAS 1354030-49-1 appears in our catalog under these names: 4-(2,3-Dichlorophenyl)piperidine hydrochloride, 95%, 4-(2,3-Dichlorophenyl)piperidine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
4-(2,3-dichlorophenyl)piperidine;hydrochloride (CAS 1354030-49-1) is a chemical compound with the molecular formula C11H14Cl3N and a molecular weight of 266.6 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)piperidine;hydrochloride. InChIKey: TZPQSCZOQUDKLV-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3N |
|---|---|
| Molecular weight | 266.6 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)piperidine;hydrochloride |
| InChIKey | TZPQSCZOQUDKLV-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=C(C(=CC=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)