CAS 941711-46-2 appears in our catalog under these names: 4-(3,4-Dichlorophenyl)piperidine hydrochloride, 95%, 4-(3,4-Dichlorophenyl)piperidine hydrochloride, 97%, 4-(3,4-Dichlorophenyl)piperidine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
4-(3,4-dichlorophenyl)piperidine;hydrochloride (CAS 941711-46-2) is a chemical compound with the molecular formula C11H14Cl3N and a molecular weight of 266.6 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)piperidine;hydrochloride. InChIKey: OLLFIIRHBCZFGF-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3N |
|---|---|
| Molecular weight | 266.6 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)piperidine;hydrochloride |
| InChIKey | OLLFIIRHBCZFGF-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)