Products 2602564-69-0
CAS 2602564-69-0 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)piperidine hydrochloride, 95%, 95%, 2-(3,4-dichlorophenyl)piperidine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-(3,4-dichlorophenyl)piperidine;hydrochloride (CAS 2602564-69-0) is a chemical compound with the molecular formula C11H14Cl3N and a molecular weight of 266.6 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)piperidine;hydrochloride. InChIKey: VTVCFDJLABNSKL-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3N |
|---|---|
| Molecular weight | 266.6 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)piperidine;hydrochloride |
| InChIKey | VTVCFDJLABNSKL-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)