CAS 1354627-91-0 appears in our catalog under these names: (E)-1-(5-Bromo-2-hydroxyphenyl)-3-(dimethylamino)prop-2-en-1-one, 95%, 95%, (E)-1-(5-Bromo-2-hydroxyphenyl)-3-(dimethylamino)prop-2-en-1-one, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
(E)-1-(5-bromo-2-hydroxyphenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 1354627-91-0) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: (E)-1-(5-bromo-2-hydroxyphenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: OTGNSEPCAXMNCM-AATRIKPKSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | (E)-1-(5-bromo-2-hydroxyphenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | OTGNSEPCAXMNCM-AATRIKPKSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=C(C=CC(=C1)Br)O |
Computed by PubChem (NCBI)