CAS 1354705-11-5 appears in our catalog under these names: Methyl 4-iodo-1-isopropyl-1H-pyrazole-3-carboxylate, 97%, 4-Iodo-1-isopropyl-1H-pyrazole-3-carboxylic acid methyl ester. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Methyl 4-iodo-1-propan-2-ylpyrazole-3-carboxylate (CAS 1354705-11-5) is a chemical compound with the molecular formula C8H11IN2O2 and a molecular weight of 294.09 g/mol. IUPAC name: methyl 4-iodo-1-propan-2-ylpyrazole-3-carboxylate. InChIKey: KOENOMHNKIOMGJ-UHFFFAOYSA-N.
| Molecular formula | C8H11IN2O2 |
|---|---|
| Molecular weight | 294.09 g/mol |
| IUPAC name | methyl 4-iodo-1-propan-2-ylpyrazole-3-carboxylate |
| InChIKey | KOENOMHNKIOMGJ-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C(=N1)C(=O)OC)I |
Computed by PubChem (NCBI)