CAS 1354752-72-9 appears in our catalog under these names: (R)-Fmoc-3-benzyl-piperidine-3-carboxylic acid, 98%, (R)-Fmoc-3-benzyl-piperidine-3-carboxylic acid, 97%, 97%, (R)-Fmoc-3-benzyl-piperidine-3-carboxylic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(3R)-3-benzyl-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid (CAS 1354752-72-9) is a chemical compound with the molecular formula C28H27NO4 and a molecular weight of 441.5 g/mol. IUPAC name: (3R)-3-benzyl-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid. InChIKey: MPPGEVRAOIMFQJ-MUUNZHRXSA-N.
| Molecular formula | C28H27NO4 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | (3R)-3-benzyl-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid |
| InChIKey | MPPGEVRAOIMFQJ-MUUNZHRXSA-N |
| SMILES | C1C[C@](CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)(CC5=CC=CC=C5)C(=O)O |
Computed by PubChem (NCBI)