CAS 365550-63-6 appears in our catalog under these names: Cis-1-amino-4-phenylcyclohexanecarboxylic acid, n-fmoc protected, 95%, Fmoc-cis-Apc, Fmoc-cis-1-amino-4-phenyl-cyclohexane carboxylic acid, Fmoc-cis-1-amino-4-phenyl-cyclohexane ca, rboxylic acid, 50 mg, Fmoc-cis-1-amino-4-phenyl-cyclohexane ca, rboxylic acid, 100 mg. Offered by: Combi-blocks, Iris Biotech, Biosynth, Roth. Available pack sizes: 250mg, 1g, 5g, 0,05g, 0,1g, 0,25g, 0,5g, 50mg.
1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylcyclohexane-1-carboxylic acid (CAS 365550-63-6) is a chemical compound with the molecular formula C28H27NO4 and a molecular weight of 441.5 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylcyclohexane-1-carboxylic acid. InChIKey: VRDHFYXVHXGOJV-UHFFFAOYSA-N.
| Molecular formula | C28H27NO4 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylcyclohexane-1-carboxylic acid |
| InChIKey | VRDHFYXVHXGOJV-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=CC=CC=C2)(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)