Products 2349966-12-5
CAS 2349966-12-5 is the registry number for Fmoc-4-(Indan-2-yl)-Abu-OH, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-4-(2,3-dihydro-1H-inden-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 2349966-12-5) is a chemical compound with the molecular formula C28H27NO4 and a molecular weight of 441.5 g/mol. IUPAC name: (2S)-4-(2,3-dihydro-1H-inden-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: FEKWJICBBLAWJB-SANMLTNESA-N.
| Molecular formula | C28H27NO4 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | (2S)-4-(2,3-dihydro-1H-inden-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | FEKWJICBBLAWJB-SANMLTNESA-N |
| SMILES | C1C(CC2=CC=CC=C21)CC[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)