CAS 1354758-03-4 appears in our catalog under these names: Methyl 7-bromo-1H-benzotriazole-5-carboxylate, 98%, Methyl 7-bromo-1H-benzotriazole-5-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g.
Methyl 7-bromo-2H-benzotriazole-5-carboxylate (CAS 1354758-03-4) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: methyl 7-bromo-2H-benzotriazole-5-carboxylate. InChIKey: OZWKQWWQLBRWJU-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O2 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | methyl 7-bromo-2H-benzotriazole-5-carboxylate |
| InChIKey | OZWKQWWQLBRWJU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=NNN=C2C(=C1)Br |
Computed by PubChem (NCBI)