CAS 1354952-03-6 appears in our catalog under these names: 3-(1-Methyl-1H-1,3-benzodiazol-2-yl)aniline hydrochloride, 95%, 3-(1-Methyl-1H-1,3-benzodiazol-2-yl)aniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-(1-methylbenzimidazol-2-yl)aniline;hydrochloride (CAS 1354952-03-6) is a chemical compound with the molecular formula C14H14ClN3 and a molecular weight of 259.73 g/mol. IUPAC name: 3-(1-methylbenzimidazol-2-yl)aniline;hydrochloride. InChIKey: HFERXAFXEGBZQF-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 3-(1-methylbenzimidazol-2-yl)aniline;hydrochloride |
| InChIKey | HFERXAFXEGBZQF-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2N=C1C3=CC(=CC=C3)N.Cl |
Computed by PubChem (NCBI)