CAS 3018-68-6 is the registry number for 2-Methyl-1-phenyl-1H-1,3-benzodiazol-5-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-methyl-1-phenylbenzimidazol-5-amine;hydrochloride (CAS 3018-68-6) is a chemical compound with the molecular formula C14H14ClN3 and a molecular weight of 259.73 g/mol. IUPAC name: 2-methyl-1-phenylbenzimidazol-5-amine;hydrochloride. InChIKey: WBLRTQBJKQTXMV-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 2-methyl-1-phenylbenzimidazol-5-amine;hydrochloride |
| InChIKey | WBLRTQBJKQTXMV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C3=CC=CC=C3)C=CC(=C2)N.Cl |
Computed by PubChem (NCBI)