Products 884316-50-1
CAS 884316-50-1 is the registry number for 4-Chloro-3-isopropyl-1-methyl-1h-pyrazolo[3,4-b]quinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
4-chloro-1-methyl-3-propan-2-ylpyrazolo[3,4-b]quinoline (CAS 884316-50-1) is a chemical compound with the molecular formula C14H14ClN3 and a molecular weight of 259.73 g/mol. IUPAC name: 4-chloro-1-methyl-3-propan-2-ylpyrazolo[3,4-b]quinoline. InChIKey: BDHHAAHCISGPLC-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | 4-chloro-1-methyl-3-propan-2-ylpyrazolo[3,4-b]quinoline |
| InChIKey | BDHHAAHCISGPLC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C2=NC3=CC=CC=C3C(=C12)Cl)C |
Computed by PubChem (NCBI)