CAS 1354954-13-4 appears in our catalog under these names: 2-(5-Methyl-4-phenyl-1,3-thiazol-2-yl)ethan-1-amine dihydrochloride, 95%, 2-(5-Methyl-4-phenyl-1,3-thiazol-2-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)ethanamine;dihydrochloride (CAS 1354954-13-4) is a chemical compound with the molecular formula C12H16Cl2N2S and a molecular weight of 291.2 g/mol. IUPAC name: 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)ethanamine;dihydrochloride. InChIKey: YGAJDBVTOJCTFQ-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2S |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | 2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | YGAJDBVTOJCTFQ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)CCN)C2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)