CAS 1677681-05-8 appears in our catalog under these names: 1-(Benzo[b]thiophen-4-yl)piperazine dihydrochloride, 97%, 1-(Benzo(b)thiophen-4-yl)piperazine dihydrochloride, 97%, 1–(Benzo(b)thiophen–4–yl)piperazine dihydrochloride, 1-(Benzo[b]thiophen-4-yl)piperazine dihydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g.
1-(1-benzothiophen-4-yl)piperazine;dihydrochloride (CAS 1677681-05-8) is a chemical compound with the molecular formula C12H16Cl2N2S and a molecular weight of 291.2 g/mol. IUPAC name: 1-(1-benzothiophen-4-yl)piperazine;dihydrochloride. InChIKey: UNMUGUDMFAWBOP-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2S |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | 1-(1-benzothiophen-4-yl)piperazine;dihydrochloride |
| InChIKey | UNMUGUDMFAWBOP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C3C=CSC3=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)