CAS 2418596-95-7 appears in our catalog under these names: (S)-1-(4-(4-Methylthiazol-5-yl)phenyl)ethan-1-amine dihydrochloride, 98%, (S)-1-(4-(4-Methylthiazol-5-yl)phenyl)ethan-1-amine dihydrochloride, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 500mg, 2.5g.
(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine;dihydrochloride (CAS 2418596-95-7) is a chemical compound with the molecular formula C12H16Cl2N2S and a molecular weight of 291.2 g/mol. IUPAC name: (1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine;dihydrochloride. InChIKey: NWIMPCHBIZHFHO-JZGIKJSDSA-N.
| Molecular formula | C12H16Cl2N2S |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | (1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethanamine;dihydrochloride |
| InChIKey | NWIMPCHBIZHFHO-JZGIKJSDSA-N |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)N.Cl.Cl |
Computed by PubChem (NCBI)