CAS 1354960-08-9 appears in our catalog under these names: 2-(2,5-Dimethylphenyl)-5-methylmorpholine hydrochloride, 98%, 2-(2,5-Dimethylphenyl)-5-methylmorpholine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2,5-dimethylphenyl)-5-methylmorpholine;hydrochloride (CAS 1354960-08-9) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)-5-methylmorpholine;hydrochloride. InChIKey: AKDAOSWWAJYLRW-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 241.76 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)-5-methylmorpholine;hydrochloride |
| InChIKey | AKDAOSWWAJYLRW-UHFFFAOYSA-N |
| SMILES | CC1COC(CN1)C2=C(C=CC(=C2)C)C.Cl |
Computed by PubChem (NCBI)