CAS 1354961-77-5 appears in our catalog under these names: 2,2,2-Trifluoroethyl N-(2-oxo-2H-chromen-6-yl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(2-oxo-2H-chromen-6-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2,2,2-trifluoroethyl N-(2-oxochromen-6-yl)carbamate (CAS 1354961-77-5) is a chemical compound with the molecular formula C12H8F3NO4 and a molecular weight of 287.19 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(2-oxochromen-6-yl)carbamate. InChIKey: PBRDJMLJYQJFHV-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO4 |
|---|---|
| Molecular weight | 287.19 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(2-oxochromen-6-yl)carbamate |
| InChIKey | PBRDJMLJYQJFHV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)