Products 1570497-18-5
CAS 1570497-18-5 is the registry number for Methyl 5-(4-(trifluoromethoxy)phenyl)isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-3-carboxylate (CAS 1570497-18-5) is a chemical compound with the molecular formula C12H8F3NO4 and a molecular weight of 287.19 g/mol. IUPAC name: methyl 5-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-3-carboxylate. InChIKey: YSSIFKLDJRNMEN-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO4 |
|---|---|
| Molecular weight | 287.19 g/mol |
| IUPAC name | methyl 5-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-3-carboxylate |
| InChIKey | YSSIFKLDJRNMEN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)