CAS 943994-23-8 is the registry number for 4,4,4-Trifluoro-1-(3-oxo-3,4-dihydro-2h-benzo[1,4]oxazin-6-yl)-butane-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,4,4-trifluoro-1-(3-oxo-4H-1,4-benzoxazin-6-yl)butane-1,3-dione (CAS 943994-23-8) is a chemical compound with the molecular formula C12H8F3NO4 and a molecular weight of 287.19 g/mol. IUPAC name: 4,4,4-trifluoro-1-(3-oxo-4H-1,4-benzoxazin-6-yl)butane-1,3-dione. InChIKey: SRSSAAPYCVTMKP-UHFFFAOYSA-N.
| Molecular formula | C12H8F3NO4 |
|---|---|
| Molecular weight | 287.19 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(3-oxo-4H-1,4-benzoxazin-6-yl)butane-1,3-dione |
| InChIKey | SRSSAAPYCVTMKP-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)