CAS 1354963-10-2 appears in our catalog under these names: 2-Chloro-N-[4-phenyl-5-(propan-2-yl)-1,3-thiazol-2-yl]acetamide, 95%, 2-Chloro-N-[4-phenyl-5-(propan-2-yl)-1,3-thiazol-2-yl]acetamide, 95%, 95%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-chloro-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide (CAS 1354963-10-2) is a chemical compound with the molecular formula C14H15ClN2OS and a molecular weight of 294.8 g/mol. IUPAC name: 2-chloro-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide. InChIKey: UDKRWKUPYQWIND-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2OS |
|---|---|
| Molecular weight | 294.8 g/mol |
| IUPAC name | 2-chloro-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)acetamide |
| InChIKey | UDKRWKUPYQWIND-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N=C(S1)NC(=O)CCl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)