CAS 1354963-79-3 is the registry number for (Thiophen-2-ylmethyl)(2,2,2-trifluoroethyl)amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2,2-trifluoro-N-(thiophen-2-ylmethyl)ethanamine;hydrochloride (CAS 1354963-79-3) is a chemical compound with the molecular formula C7H9ClF3NS and a molecular weight of 231.67 g/mol. IUPAC name: 2,2,2-trifluoro-N-(thiophen-2-ylmethyl)ethanamine;hydrochloride. InChIKey: BAFHZUKGFHQQAX-UHFFFAOYSA-N.
| Molecular formula | C7H9ClF3NS |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-(thiophen-2-ylmethyl)ethanamine;hydrochloride |
| InChIKey | BAFHZUKGFHQQAX-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CNCC(F)(F)F.Cl |
Computed by PubChem (NCBI)