CAS 1432679-31-6 appears in our catalog under these names: 2-[5-(Trifluoromethyl)thiophen-2-yl]ethan-1-amine hydrochloride, 95%, 95%, 2-[5-(Trifluoromethyl)thiophen-2-yl]ethan-1-amine hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-[5-(trifluoromethyl)thiophen-2-yl]ethanamine;hydrochloride (CAS 1432679-31-6) is a chemical compound with the molecular formula C7H9ClF3NS and a molecular weight of 231.67 g/mol. IUPAC name: 2-[5-(trifluoromethyl)thiophen-2-yl]ethanamine;hydrochloride. InChIKey: SKQJMFOMRXRZBO-UHFFFAOYSA-N.
| Molecular formula | C7H9ClF3NS |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | 2-[5-(trifluoromethyl)thiophen-2-yl]ethanamine;hydrochloride |
| InChIKey | SKQJMFOMRXRZBO-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C(F)(F)F)CCN.Cl |
Computed by PubChem (NCBI)