CAS 1820736-32-0 appears in our catalog under these names: 3,3,3-Trifluoro-1-(thiophen-3-yl)propan-1-amine hydrochloride, 95%, 3,3,3-Trifluoro-1-(thiophen-3-yl)propan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,3,3-trifluoro-1-thiophen-3-ylpropan-1-amine;hydrochloride (CAS 1820736-32-0) is a chemical compound with the molecular formula C7H9ClF3NS and a molecular weight of 231.67 g/mol. IUPAC name: 3,3,3-trifluoro-1-thiophen-3-ylpropan-1-amine;hydrochloride. InChIKey: CHXYCXSZSMDTMS-UHFFFAOYSA-N.
| Molecular formula | C7H9ClF3NS |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | 3,3,3-trifluoro-1-thiophen-3-ylpropan-1-amine;hydrochloride |
| InChIKey | CHXYCXSZSMDTMS-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C(CC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)