CAS 1354970-76-5 appears in our catalog under these names: (1S)-1-(4-Phenylphenyl)ethan-1-amine hydrochloride, 95%, (1S)–1–(4–Phenylphenyl)ethan–1–amine hydrochloride, (1S)-1-{(1,1'-Biphenyl)-4-yl}ethan-1-amine hydrochloride, (1S)-1-(4-Phenylphenyl)ethan-1-amine hydrochloride 95%, (1S)-1-(4-Phenylphenyl)ethan-1-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(1S)-1-(4-phenylphenyl)ethanamine;hydrochloride (CAS 1354970-76-5) is a chemical compound with the molecular formula C14H16ClN and a molecular weight of 233.73 g/mol. IUPAC name: (1S)-1-(4-phenylphenyl)ethanamine;hydrochloride. InChIKey: KATCFWMBDRASHY-MERQFXBCSA-N.
| Molecular formula | C14H16ClN |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | (1S)-1-(4-phenylphenyl)ethanamine;hydrochloride |
| InChIKey | KATCFWMBDRASHY-MERQFXBCSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)