CAS 5267-49-2 appears in our catalog under these names: [(4-Methylphenyl)(phenyl)methyl]amine hydrochloride, 95%, Phenyl(p-tolyl)methanamine hydrochloride, 98%, (4-Methylphenyl)(phenyl)methanamine hydrochloride, Phenyl(p-tolyl)methanamine hydrochloride, 98%, 98%, [(4-methylphenyl)(phenyl)methyl]amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
(4-methylphenyl)-phenylmethanamine;hydrochloride (CAS 5267-49-2) is a chemical compound with the molecular formula C14H16ClN and a molecular weight of 233.73 g/mol. IUPAC name: (4-methylphenyl)-phenylmethanamine;hydrochloride. InChIKey: NHTZSJKMWBONMD-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | (4-methylphenyl)-phenylmethanamine;hydrochloride |
| InChIKey | NHTZSJKMWBONMD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)