CAS 5267-48-1 appears in our catalog under these names: [(3-Methylphenyl)(phenyl)methyl]amine hydrochloride, 95%, ((3-Methylphenyl)(phenyl)methyl)amine hydrochloride, [(3-Methylphenyl)(phenyl)methyl]amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 25g, 10g, 1g, 500mg, 1000mg, 2000mg.
(3-methylphenyl)-phenylmethanamine;hydrochloride (CAS 5267-48-1) is a chemical compound with the molecular formula C14H16ClN and a molecular weight of 233.73 g/mol. IUPAC name: (3-methylphenyl)-phenylmethanamine;hydrochloride. InChIKey: NDFHIOAWQHPWSW-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | (3-methylphenyl)-phenylmethanamine;hydrochloride |
| InChIKey | NDFHIOAWQHPWSW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)