CAS 135498-43-0 is the registry number for Cetilistat Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethoxy-6-methyl-3,1-benzoxazin-4-one (CAS 135498-43-0) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 2-ethoxy-6-methyl-3,1-benzoxazin-4-one. InChIKey: ZKWXJEXMJCTFIZ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2-ethoxy-6-methyl-3,1-benzoxazin-4-one |
| InChIKey | ZKWXJEXMJCTFIZ-UHFFFAOYSA-N |
| SMILES | CCOC1=NC2=C(C=C(C=C2)C)C(=O)O1 |
Computed by PubChem (NCBI)