CAS 1355083-61-2 appears in our catalog under these names: 2-(3-Ethyl-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(3-Ethyl-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(3-ethyl-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1355083-61-2) is a chemical compound with the molecular formula C14H20BFO2 and a molecular weight of 250.12 g/mol. IUPAC name: 2-(3-ethyl-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NFRWXBKYUXRKQL-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 2-(3-ethyl-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NFRWXBKYUXRKQL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)CC |
Computed by PubChem (NCBI)