CAS 2096341-90-9 appears in our catalog under these names: 3,5-Dimethyl-2-fluorophenylboronic acid, pinacol ester, 98%, 3,5-Dimethyl-2-fluorophenylboronic acid, pinacol ester, 98%, 98%, 2-(2-Fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
2-(2-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2096341-90-9) is a chemical compound with the molecular formula C14H20BFO2 and a molecular weight of 250.12 g/mol. IUPAC name: 2-(2-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RMWQMFCRBPVMHF-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 2-(2-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RMWQMFCRBPVMHF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)C)C |
Computed by PubChem (NCBI)