CAS 2121512-41-0 appears in our catalog under these names: 2-(4-Fluoro-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2,6-Dimethyl-4-fluorophenylboronic acid pinacol ester. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(4-fluoro-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-41-0) is a chemical compound with the molecular formula C14H20BFO2 and a molecular weight of 250.12 g/mol. IUPAC name: 2-(4-fluoro-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NYCCGTUGVZBFTF-UHFFFAOYSA-N.
| Molecular formula | C14H20BFO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 2-(4-fluoro-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NYCCGTUGVZBFTF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2C)F)C |
Computed by PubChem (NCBI)