CAS 135513-20-1 is the registry number for Diphenylmethyl Mesylate (Technical Grade). Offered by: TRC. Available pack sizes: 500mg.
Benzhydryl methanesulfonate (CAS 135513-20-1) is a chemical compound with the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. IUPAC name: benzhydryl methanesulfonate. InChIKey: QKVUIWDHQSAFHI-UHFFFAOYSA-N.
| Molecular formula | C14H14O3S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | benzhydryl methanesulfonate |
| InChIKey | QKVUIWDHQSAFHI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)