Products 135513-20-1

CAS 135513-20-1 is the registry number for Diphenylmethyl Mesylate (Technical Grade). Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

Benzhydryl methanesulfonate (CAS 135513-20-1) is a chemical compound with the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. IUPAC name: benzhydryl methanesulfonate. InChIKey: QKVUIWDHQSAFHI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O3S
Molecular weight262.33 g/mol
IUPAC namebenzhydryl methanesulfonate
InChIKeyQKVUIWDHQSAFHI-UHFFFAOYSA-N
SMILESCS(=O)(=O)OC(C1=CC=CC=C1)C2=CC=CC=C2

Computed by PubChem (NCBI)