CAS 1355195-80-0 is the registry number for 6'-Fluoro-1'H-spiro(piperidine-4,2'-quinazolin)-4'(3'H)-one. Offered by: TRC. Available pack sizes: 250mg.
6-fluorospiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one (CAS 1355195-80-0) is a chemical compound with the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. IUPAC name: 6-fluorospiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one. InChIKey: YJTRKYQLCXMZHK-UHFFFAOYSA-N.
| Molecular formula | C12H14FN3O |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 6-fluorospiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one |
| InChIKey | YJTRKYQLCXMZHK-UHFFFAOYSA-N |
| SMILES | C1CNCCC12NC3=C(C=C(C=C3)F)C(=O)N2 |
Computed by PubChem (NCBI)