Products 2891599-70-3
CAS 2891599-70-3 is the registry number for 5-fluoro-1-tetrahydropyran-2-yl-indazol-6-amine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-fluoro-1-(oxan-2-yl)indazol-6-amine (CAS 2891599-70-3) is a chemical compound with the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. IUPAC name: 5-fluoro-1-(oxan-2-yl)indazol-6-amine. InChIKey: WPNVXIAZXPEDOD-UHFFFAOYSA-N.
| Molecular formula | C12H14FN3O |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 5-fluoro-1-(oxan-2-yl)indazol-6-amine |
| InChIKey | WPNVXIAZXPEDOD-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=CC(=C(C=C3C=N2)F)N |
Computed by PubChem (NCBI)