CAS 548487-68-9 is the registry number for Flumazenil Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
2-(dimethylamino)-7-fluoro-4-methyl-3H-1,4-benzodiazepin-5-one (CAS 548487-68-9) is a chemical compound with the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. IUPAC name: 2-(dimethylamino)-7-fluoro-4-methyl-3H-1,4-benzodiazepin-5-one. InChIKey: JIDOSWIFKSCNJI-UHFFFAOYSA-N.
| Molecular formula | C12H14FN3O |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 2-(dimethylamino)-7-fluoro-4-methyl-3H-1,4-benzodiazepin-5-one |
| InChIKey | JIDOSWIFKSCNJI-UHFFFAOYSA-N |
| SMILES | CN1CC(=NC2=C(C1=O)C=C(C=C2)F)N(C)C |
Computed by PubChem (NCBI)