CAS 1355200-53-1 is the registry number for 6-Methoxy-2-methyl-α-phenyl-3-pyridinemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(6-methoxy-2-methyl-3-pyridinyl)-phenylmethanol (CAS 1355200-53-1) is a chemical compound with the molecular formula C14H15NO2 and a molecular weight of 229.27 g/mol. IUPAC name: (6-methoxy-2-methyl-3-pyridinyl)-phenylmethanol. InChIKey: QWTUQRUJERCLCV-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (6-methoxy-2-methyl-3-pyridinyl)-phenylmethanol |
| InChIKey | QWTUQRUJERCLCV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)OC)C(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)