Products 1355334-86-9

CAS 1355334-86-9 appears in our catalog under these names: 3-Methyl-1,2-thiazole-5-sulfonyl chloride, 95%, 3-Methyl-isothiazole-5-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3-methyl-1,2-thiazole-5-sulfonyl chloride (CAS 1355334-86-9) is a chemical compound with the molecular formula C4H4ClNO2S2 and a molecular weight of 197.7 g/mol. IUPAC name: 3-methyl-1,2-thiazole-5-sulfonyl chloride. InChIKey: LJTRGHGACFEWIM-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4ClNO2S2
Molecular weight197.7 g/mol
IUPAC name3-methyl-1,2-thiazole-5-sulfonyl chloride
InChIKeyLJTRGHGACFEWIM-UHFFFAOYSA-N
SMILESCC1=NSC(=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)