Products 754966-95-5

CAS 754966-95-5 appears in our catalog under these names: 1,3-Thiazol-4-ylmethanesulfonyl chloride, 95%, 1,3-Thiazol-4-ylmethanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

1,3-thiazol-4-ylmethanesulfonyl chloride (CAS 754966-95-5) is a chemical compound with the molecular formula C4H4ClNO2S2 and a molecular weight of 197.7 g/mol. IUPAC name: 1,3-thiazol-4-ylmethanesulfonyl chloride. InChIKey: FAMMKHWQINTCOB-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4ClNO2S2
Molecular weight197.7 g/mol
IUPAC name1,3-thiazol-4-ylmethanesulfonyl chloride
InChIKeyFAMMKHWQINTCOB-UHFFFAOYSA-N
SMILESC1=C(N=CS1)CS(=O)(=O)Cl

Computed by PubChem (NCBI)