Products 892878-72-7

CAS 892878-72-7 is the registry number for 5-Methylthiazole-2-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-methyl-1,3-thiazole-2-sulfonyl chloride (CAS 892878-72-7) is a chemical compound with the molecular formula C4H4ClNO2S2 and a molecular weight of 197.7 g/mol. IUPAC name: 5-methyl-1,3-thiazole-2-sulfonyl chloride. InChIKey: OPHYLBMHMOURHK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4ClNO2S2
Molecular weight197.7 g/mol
IUPAC name5-methyl-1,3-thiazole-2-sulfonyl chloride
InChIKeyOPHYLBMHMOURHK-UHFFFAOYSA-N
SMILESCC1=CN=C(S1)S(=O)(=O)Cl

Computed by PubChem (NCBI)