CAS 1355334-89-2 is the registry number for (1,4-Diphenyl-1h-pyrrol-3-yl)-methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(1,4-diphenylpyrrol-3-yl)methanol (CAS 1355334-89-2) is a chemical compound with the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. IUPAC name: (1,4-diphenylpyrrol-3-yl)methanol. InChIKey: YPPIRDJISPJQRI-UHFFFAOYSA-N.
| Molecular formula | C17H15NO |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | (1,4-diphenylpyrrol-3-yl)methanol |
| InChIKey | YPPIRDJISPJQRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN(C=C2CO)C3=CC=CC=C3 |
Computed by PubChem (NCBI)