CAS 139093-77-9 appears in our catalog under these names: Ketoprofen Impurity 31, 2-(3-(4-methylbenzoyl)phenyl)propanenitrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 25mg, 50mg.
2-[3-(4-methylbenzoyl)phenyl]propanenitrile (CAS 139093-77-9) is a chemical compound with the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. IUPAC name: 2-[3-(4-methylbenzoyl)phenyl]propanenitrile. InChIKey: CFNNQKPYSKQZSN-UHFFFAOYSA-N.
| Molecular formula | C17H15NO |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | 2-[3-(4-methylbenzoyl)phenyl]propanenitrile |
| InChIKey | CFNNQKPYSKQZSN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)C(C)C#N |
Computed by PubChem (NCBI)