CAS 347332-11-0 appears in our catalog under these names: 2,5-Dimethyl-1-(1-naphthyl)-1h-pyrrole-3-carbaldehyde, 95%, 2,5-Dimethyl-1-(naphthalen-1-yl)-1H-pyrrole-3-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g.
2,5-dimethyl-1-naphthalen-1-ylpyrrole-3-carbaldehyde (CAS 347332-11-0) is a chemical compound with the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. IUPAC name: 2,5-dimethyl-1-naphthalen-1-ylpyrrole-3-carbaldehyde. InChIKey: VFVGOFDVIDSZQD-UHFFFAOYSA-N.
| Molecular formula | C17H15NO |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | 2,5-dimethyl-1-naphthalen-1-ylpyrrole-3-carbaldehyde |
| InChIKey | VFVGOFDVIDSZQD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC3=CC=CC=C32)C)C=O |
Computed by PubChem (NCBI)