Products 461027-81-6
CAS 461027-81-6 is the registry number for N-(2-chloro-5-nitrophenyl)-2,2-diphenylethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2-chloro-5-nitrophenyl)-2,2-diphenylacetamide (CAS 461027-81-6) is a chemical compound with the molecular formula C20H15ClN2O3 and a molecular weight of 366.8 g/mol. IUPAC name: N-(2-chloro-5-nitrophenyl)-2,2-diphenylacetamide. InChIKey: DTJKNASQHUXHPA-UHFFFAOYSA-N.
| Molecular formula | C20H15ClN2O3 |
|---|---|
| Molecular weight | 366.8 g/mol |
| IUPAC name | N-(2-chloro-5-nitrophenyl)-2,2-diphenylacetamide |
| InChIKey | DTJKNASQHUXHPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)NC3=C(C=CC(=C3)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)