Products 13559-66-5

CAS 13559-66-5 is the registry number for 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one oxime, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine (CAS 13559-66-5) is a chemical compound with the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. IUPAC name: N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine. InChIKey: OVFDEGGJFJECAT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO
Molecular weight167.25 g/mol
IUPAC nameN-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine
InChIKeyOVFDEGGJFJECAT-UHFFFAOYSA-N
SMILESCC1(C2CCC1(C(=NO)C2)C)C

Computed by PubChem (NCBI)