CAS 2792-42-9 appears in our catalog under these names: (1R)-Camphor oxime, 98%, (1R)–Camphor Oxime, (1R)-Camphor Oxime, >98.0%(GC), (1R,4R)-1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one oxime, (1R,E)-1,7,7-trimethylbicyclo[2.2.1]Heptan-2-one oxime, ≥98%(GC). Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 200mg.
N-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (CAS 2792-42-9) is a chemical compound with the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. IUPAC name: N-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine. InChIKey: OVFDEGGJFJECAT-XCBNKYQSSA-N.
| Molecular formula | C10H17NO |
|---|---|
| Molecular weight | 167.25 g/mol |
| IUPAC name | N-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| InChIKey | OVFDEGGJFJECAT-XCBNKYQSSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)CC2=NO |
Computed by PubChem (NCBI)