CAS 1356009-25-0 is the registry number for 2-(3-Methyl-1H-1,2,4-triazol-1-yl)-5-nitrophenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenol (CAS 1356009-25-0) is a chemical compound with the molecular formula C9H8N4O3 and a molecular weight of 220.18 g/mol. IUPAC name: 2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenol. InChIKey: TXTSYANGGMJBIE-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O3 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 2-(3-methyl-1,2,4-triazol-1-yl)-5-nitrophenol |
| InChIKey | TXTSYANGGMJBIE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=N1)C2=C(C=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)