CAS 90886-87-6 is the registry number for (1-(4-Nitrophenyl)-1H-1,2,3-triazol-4-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-(4-nitrophenyl)triazol-4-yl]methanol (CAS 90886-87-6) is a chemical compound with the molecular formula C9H8N4O3 and a molecular weight of 220.18 g/mol. IUPAC name: [1-(4-nitrophenyl)triazol-4-yl]methanol. InChIKey: NIFGKSJKCMZAEF-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O3 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | [1-(4-nitrophenyl)triazol-4-yl]methanol |
| InChIKey | NIFGKSJKCMZAEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)