CAS 1609394-05-9 is the registry number for BMS-986165 Related Compound 1. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-methoxy-3-nitrophenyl)-1H-1,2,4-triazole (CAS 1609394-05-9) is a chemical compound with the molecular formula C9H8N4O3 and a molecular weight of 220.18 g/mol. IUPAC name: 5-(2-methoxy-3-nitrophenyl)-1H-1,2,4-triazole. InChIKey: CMGVPTUXPJERNL-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O3 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 5-(2-methoxy-3-nitrophenyl)-1H-1,2,4-triazole |
| InChIKey | CMGVPTUXPJERNL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1[N+](=O)[O-])C2=NC=NN2 |
Computed by PubChem (NCBI)